C18H26F3NO4S — CID 138973900
tert-butyl 7-phenyl-4-(trifluoromethylsulfonylamino)heptanoate (PubChem CID 138973900) has the molecular formula C18H26F3NO4S and a molecular weight of 409.47 g/mol. Its IUPAC name is tert-butyl 7-phenyl-4-(trifluoromethylsulfonylamino)heptanoate.
| Compound Name | tert-butyl 7-phenyl-4-(trifluoromethylsulfonylamino)heptanoate |
|---|---|
| PubChem CID | 138973900 |
| Molecular Formula | C18H26F3NO4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | tert-butyl 7-phenyl-4-(trifluoromethylsulfonylamino)heptanoate |
| SMILES | CC(C)(C)OC(=O)CCC(CCCc1ccccc1)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C18H26F3NO4S/c1-17(2,3)26-16(23)13-12-15(22-27(24,25)18(19,20)21)11-7-10-14-8-5-4-6-9-14/h4-6,8-9,15,22H,7,10-13H2,1-3H3 |
| InChIKey | OBBFXDOPCOXMDG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |