C10H11F3N4O2S — CID 135040471
N-[(2S)-1-azido-3-phenylpropan-2-yl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 135040471) has the molecular formula C10H11F3N4O2S and a molecular weight of 308.29 g/mol. Its IUPAC name is N-[(2S)-1-azido-3-phenylpropan-2-yl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[(2S)-1-azido-3-phenylpropan-2-yl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 135040471 |
| Molecular Formula | C10H11F3N4O2S |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | N-[(2S)-1-azido-3-phenylpropan-2-yl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | [N-]=[N+]=NC[C@H](Cc1ccccc1)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N4O2S/c11-10(12,13)20(18,19)16-9(7-15-17-14)6-8-4-2-1-3-5-8/h1-5,9,16H,6-7H2/t9-/m0/s1 |
| InChIKey | QVWHMMQCBLNJBA-VIFPVBQESA-N |
| XLogP | 2.35 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|