C28H31N5O2 — CID 45378330
N-[1-[[(2S)-1-azido-3-phenylpropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]-N-[(1S)-1-phenylethyl]benzamide (PubChem CID 45378330) has the molecular formula C28H31N5O2 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-[1-[[(2S)-1-azido-3-phenylpropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]-N-[(1S)-1-phenylethyl]benzamide.
| Compound Name | N-[1-[[(2S)-1-azido-3-phenylpropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]-N-[(1S)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 45378330 |
| Molecular Formula | C28H31N5O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | N-[1-[[(2S)-1-azido-3-phenylpropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]-N-[(1S)-1-phenylethyl]benzamide |
| SMILES | C[C@@H](c1ccccc1)N(C(=O)c1ccccc1)C(C)(C)C(=O)N[C@H](CN=[N+]=[N-])Cc1ccccc1 |
| InChI | InChI=1S/C28H31N5O2/c1-21(23-15-9-5-10-16-23)33(26(34)24-17-11-6-12-18-24)28(2,3)27(35)31-25(20-30-32-29)19-22-13-7-4-8-14-22/h4-18,21,25H,19-20H2,1-3H3,(H,31,35)/t21-,25-/m0/s1 |
| InChIKey | XNBZEANVCPOTCU-OFVILXPXSA-N |
| XLogP | 5.71 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|