C11H15N3O3 — CID 155892632
[2-(carbamoylamino)-3-phenylpropyl] carbamate (PubChem CID 155892632) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is [2-(carbamoylamino)-3-phenylpropyl] carbamate.
| Compound Name | [2-(carbamoylamino)-3-phenylpropyl] carbamate |
|---|---|
| PubChem CID | 155892632 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | [2-(carbamoylamino)-3-phenylpropyl] carbamate |
| SMILES | NC(=O)NC(COC(N)=O)Cc1ccccc1 |
| InChI | InChI=1S/C11H15N3O3/c12-10(15)14-9(7-17-11(13)16)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,13,16)(H3,12,14,15) |
| InChIKey | KGTYYCWZHBCUHU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |