C15H24ClN3O2 — CID 70188455
[(2R)-1-phenyl-3-piperidin-1-yloxypropan-2-yl]urea;hydrochloride (PubChem CID 70188455) has the molecular formula C15H24ClN3O2 and a molecular weight of 313.83 g/mol. Its IUPAC name is [(2R)-1-phenyl-3-piperidin-1-yloxypropan-2-yl]urea;hydrochloride.
| Compound Name | [(2R)-1-phenyl-3-piperidin-1-yloxypropan-2-yl]urea;hydrochloride |
|---|---|
| PubChem CID | 70188455 |
| Molecular Formula | C15H24ClN3O2 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | [(2R)-1-phenyl-3-piperidin-1-yloxypropan-2-yl]urea;hydrochloride |
| SMILES | Cl.NC(=O)N[C@@H](CON1CCCCC1)Cc1ccccc1 |
| InChI | InChI=1S/C15H23N3O2.ClH/c16-15(19)17-14(11-13-7-3-1-4-8-13)12-20-18-9-5-2-6-10-18;/h1,3-4,7-8,14H,2,5-6,9-12H2,(H3,16,17,19);1H/t14-;/m1./s1 |
| InChIKey | JTKDEADIJNTCBX-PFEQFJNWSA-N |
| XLogP | 2.11 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |