C23H29N3O4 — CID 70187024
benzyl N-carbamoyl-N-[(2R)-1-phenyl-3-piperidin-1-yloxypropan-2-yl]carbamate (PubChem CID 70187024) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is benzyl N-carbamoyl-N-[(2R)-1-phenyl-3-piperidin-1-yloxypropan-2-yl]carbamate.
| Compound Name | benzyl N-carbamoyl-N-[(2R)-1-phenyl-3-piperidin-1-yloxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 70187024 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | benzyl N-carbamoyl-N-[(2R)-1-phenyl-3-piperidin-1-yloxypropan-2-yl]carbamate |
| SMILES | NC(=O)N(C(=O)OCc1ccccc1)[C@@H](CON1CCCCC1)Cc1ccccc1 |
| InChI | InChI=1S/C23H29N3O4/c24-22(27)26(23(28)29-17-20-12-6-2-7-13-20)21(16-19-10-4-1-5-11-19)18-30-25-14-8-3-9-15-25/h1-2,4-7,10-13,21H,3,8-9,14-18H2,(H2,24,27)/t21-/m1/s1 |
| InChIKey | LVNIZKTUFIPBFL-OAQYLSRUSA-N |
| XLogP | 3.73 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |