C21H25NO3 — CID 57026029
benzyl 2-hydroxy-3-(4-piperidin-1-ylphenyl)propanoate (PubChem CID 57026029) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is benzyl 2-hydroxy-3-(4-piperidin-1-ylphenyl)propanoate.
| Compound Name | benzyl 2-hydroxy-3-(4-piperidin-1-ylphenyl)propanoate |
|---|---|
| PubChem CID | 57026029 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | benzyl 2-hydroxy-3-(4-piperidin-1-ylphenyl)propanoate |
| SMILES | O=C(OCc1ccccc1)C(O)Cc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H25NO3/c23-20(21(24)25-16-18-7-3-1-4-8-18)15-17-9-11-19(12-10-17)22-13-5-2-6-14-22/h1,3-4,7-12,20,23H,2,5-6,13-16H2 |
| InChIKey | XRHFOMXZGLEQCK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|