C21H23F2NO3 — CID 155282536
benzyl (2R)-4-[4-(3,3-difluoropyrrolidin-1-yl)phenyl]-2-hydroxybutanoate (PubChem CID 155282536) has the molecular formula C21H23F2NO3 and a molecular weight of 375.42 g/mol. Its IUPAC name is benzyl (2R)-4-[4-(3,3-difluoropyrrolidin-1-yl)phenyl]-2-hydroxybutanoate.
| Compound Name | benzyl (2R)-4-[4-(3,3-difluoropyrrolidin-1-yl)phenyl]-2-hydroxybutanoate |
|---|---|
| PubChem CID | 155282536 |
| Molecular Formula | C21H23F2NO3 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | benzyl (2R)-4-[4-(3,3-difluoropyrrolidin-1-yl)phenyl]-2-hydroxybutanoate |
| SMILES | O=C(OCc1ccccc1)[C@H](O)CCc1ccc(N2CCC(F)(F)C2)cc1 |
| InChI | InChI=1S/C21H23F2NO3/c22-21(23)12-13-24(15-21)18-9-6-16(7-10-18)8-11-19(25)20(26)27-14-17-4-2-1-3-5-17/h1-7,9-10,19,25H,8,11-15H2/t19-/m1/s1 |
| InChIKey | CCHBEWBLIZQLRH-LJQANCHMSA-N |
| XLogP | 3.57 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|