C23H24F2O3 — CID 139314643
benzyl (2R)-4-[4-(4,4-difluorocyclohexen-1-yl)phenyl]-2-hydroxybutanoate (PubChem CID 139314643) has the molecular formula C23H24F2O3 and a molecular weight of 386.44 g/mol. Its IUPAC name is benzyl (2R)-4-[4-(4,4-difluorocyclohexen-1-yl)phenyl]-2-hydroxybutanoate.
| Compound Name | benzyl (2R)-4-[4-(4,4-difluorocyclohexen-1-yl)phenyl]-2-hydroxybutanoate |
|---|---|
| PubChem CID | 139314643 |
| Molecular Formula | C23H24F2O3 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | benzyl (2R)-4-[4-(4,4-difluorocyclohexen-1-yl)phenyl]-2-hydroxybutanoate |
| SMILES | O=C(OCc1ccccc1)[C@H](O)CCc1ccc(C2=CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C23H24F2O3/c24-23(25)14-12-20(13-15-23)19-9-6-17(7-10-19)8-11-21(26)22(27)28-16-18-4-2-1-3-5-18/h1-7,9-10,12,21,26H,8,11,13-16H2/t21-/m1/s1 |
| InChIKey | WANVHMVWHFDFJF-OAQYLSRUSA-N |
| XLogP | 4.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |