C20H20F2N2O2 — CID 72663577
2-[4-(3,3-difluoropyrrolidin-1-yl)phenyl]-N-hydroxy-3-phenylcyclopropane-1-carboxamide (PubChem CID 72663577) has the molecular formula C20H20F2N2O2 and a molecular weight of 358.39 g/mol. Its IUPAC name is 2-[4-(3,3-difluoropyrrolidin-1-yl)phenyl]-N-hydroxy-3-phenylcyclopropane-1-carboxamide.
| Compound Name | 2-[4-(3,3-difluoropyrrolidin-1-yl)phenyl]-N-hydroxy-3-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 72663577 |
| Molecular Formula | C20H20F2N2O2 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-[4-(3,3-difluoropyrrolidin-1-yl)phenyl]-N-hydroxy-3-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(NO)C1C(c2ccccc2)C1c1ccc(N2CCC(F)(F)C2)cc1 |
| InChI | InChI=1S/C20H20F2N2O2/c21-20(22)10-11-24(12-20)15-8-6-14(7-9-15)17-16(18(17)19(25)23-26)13-4-2-1-3-5-13/h1-9,16-18,26H,10-12H2,(H,23,25) |
| InChIKey | VJLWXMRFMHLDQI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|