C22H23NO3 — CID 86721150
methyl (1R,2R,3R)-2-[4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)phenyl]-3-phenylcyclopropane-1-carboxylate (PubChem CID 86721150) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is methyl (1R,2R,3R)-2-[4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)phenyl]-3-phenylcyclopropane-1-carboxylate.
| Compound Name | methyl (1R,2R,3R)-2-[4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)phenyl]-3-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 86721150 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | methyl (1R,2R,3R)-2-[4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)phenyl]-3-phenylcyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](c2ccccc2)[C@H]1c1ccc(N2CC3(COC3)C2)cc1 |
| InChI | InChI=1S/C22H23NO3/c1-25-21(24)20-18(15-5-3-2-4-6-15)19(20)16-7-9-17(10-8-16)23-11-22(12-23)13-26-14-22/h2-10,18-20H,11-14H2,1H3/t18-,19-,20-/m1/s1 |
| InChIKey | PJEQXBYGNQRTTC-VAMGGRTRSA-N |
| XLogP | 3.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|