C19H23N3O2 — CID 90209361
(1R,2R,3R)-2-(2-ethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-7-yl)-N-hydroxy-3-phenylcyclopropane-1-carboxamide (PubChem CID 90209361) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is (1R,2R,3R)-2-(2-ethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-7-yl)-N-hydroxy-3-phenylcyclopropane-1-carboxamide.
| Compound Name | (1R,2R,3R)-2-(2-ethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-7-yl)-N-hydroxy-3-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 90209361 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (1R,2R,3R)-2-(2-ethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-7-yl)-N-hydroxy-3-phenylcyclopropane-1-carboxamide |
| SMILES | CCN1CCn2cc([C@H]3[C@H](C(=O)NO)[C@@H]3c3ccccc3)cc2C1 |
| InChI | InChI=1S/C19H23N3O2/c1-2-21-8-9-22-11-14(10-15(22)12-21)17-16(18(17)19(23)20-24)13-6-4-3-5-7-13/h3-7,10-11,16-18,24H,2,8-9,12H2,1H3,(H,20,23)/t16-,17-,18-/m1/s1 |
| InChIKey | NLJNDGIKRGRNAE-KZNAEPCWSA-N |
| XLogP | 2.33 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|