C21H24N2O — CID 14182204
N-benzyl-1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxamide (PubChem CID 14182204) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is N-benzyl-1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxamide.
| Compound Name | N-benzyl-1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxamide |
|---|---|
| PubChem CID | 14182204 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | N-benzyl-1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxamide |
| SMILES | CCN1CCC(c2ccccc2)=C(C(=O)NCc2ccccc2)C1 |
| InChI | InChI=1S/C21H24N2O/c1-2-23-14-13-19(18-11-7-4-8-12-18)20(16-23)21(24)22-15-17-9-5-3-6-10-17/h3-12H,2,13-16H2,1H3,(H,22,24) |
| InChIKey | WPPJYDQTHMDJCP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |