C34H50I2N4O2 — CID 2849414
2,4-diphenyl-1-N,3-N-bis(3-pyrrolidin-1-ylpropyl)cyclobutane-1,3-dicarboxamide;iodomethane (PubChem CID 2849414) has the molecular formula C34H50I2N4O2 and a molecular weight of 800.61 g/mol. Its IUPAC name is 2,4-diphenyl-1-N,3-N-bis(3-pyrrolidin-1-ylpropyl)cyclobutane-1,3-dicarboxamide;iodomethane.
| Compound Name | 2,4-diphenyl-1-N,3-N-bis(3-pyrrolidin-1-ylpropyl)cyclobutane-1,3-dicarboxamide;iodomethane |
|---|---|
| PubChem CID | 2849414 |
| Molecular Formula | C34H50I2N4O2 |
| Molecular Weight | 800.61 g/mol |
| Exact Mass | 800.20 |
| IUPAC Name | 2,4-diphenyl-1-N,3-N-bis(3-pyrrolidin-1-ylpropyl)cyclobutane-1,3-dicarboxamide;iodomethane |
| SMILES | CI.CI.O=C(NCCCN1CCCC1)C1C(c2ccccc2)C(C(=O)NCCCN2CCCC2)C1c1ccccc1 |
| InChI | InChI=1S/C32H44N4O2.2CH3I/c37-31(33-17-11-23-35-19-7-8-20-35)29-27(25-13-3-1-4-14-25)30(28(29)26-15-5-2-6-16-26)32(38)34-18-12-24-36-21-9-10-22-36;2*1-2/h1-6,13-16,27-30H,7-12,17-24H2,(H,33,37)(H,34,38);2*1H3 |
| InChIKey | NWCXJBMRIZNPIE-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.61 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|