C17H29N3 — CID 143866477
ethane;(Z)-2-(2-ethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-7-yl)-N-methylpent-2-en-1-imine (PubChem CID 143866477) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is ethane;(Z)-2-(2-ethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-7-yl)-N-methylpent-2-en-1-imine.
| Compound Name | ethane;(Z)-2-(2-ethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-7-yl)-N-methylpent-2-en-1-imine |
|---|---|
| PubChem CID | 143866477 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | ethane;(Z)-2-(2-ethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-7-yl)-N-methylpent-2-en-1-imine |
| SMILES | CC.CC/C=C(\C=N\C)c1cc2n(c1)CCN(CC)C2 |
| InChI | InChI=1S/C15H23N3.C2H6/c1-4-6-13(10-16-3)14-9-15-12-17(5-2)7-8-18(15)11-14;1-2/h6,9-11H,4-5,7-8,12H2,1-3H3;1-2H3/b13-6+,16-10+; |
| InChIKey | BQKPDKCNXQDWOL-KNIAEAGVSA-N |
| XLogP | 3.84 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|