C19H24N2OS — CID 143553140
8-ethyl-3-methylsulfanyl-5-[(3E)-penta-1,3-dien-3-yl]-3,6,7,9-tetrahydro-1H-pyrrolo[3,2-h]isoquinolin-2-one (PubChem CID 143553140) has the molecular formula C19H24N2OS and a molecular weight of 328.48 g/mol. Its IUPAC name is 8-ethyl-3-methylsulfanyl-5-[(3E)-penta-1,3-dien-3-yl]-3,6,7,9-tetrahydro-1H-pyrrolo[3,2-h]isoquinolin-2-one.
| Compound Name | 8-ethyl-3-methylsulfanyl-5-[(3E)-penta-1,3-dien-3-yl]-3,6,7,9-tetrahydro-1H-pyrrolo[3,2-h]isoquinolin-2-one |
|---|---|
| PubChem CID | 143553140 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 8-ethyl-3-methylsulfanyl-5-[(3E)-penta-1,3-dien-3-yl]-3,6,7,9-tetrahydro-1H-pyrrolo[3,2-h]isoquinolin-2-one |
| SMILES | C=C/C(=C\C)c1cc2c(c3c1CCN(CC)C3)NC(=O)C2SC |
| InChI | InChI=1S/C19H24N2OS/c1-5-12(6-2)14-10-15-17(20-19(22)18(15)23-4)16-11-21(7-3)9-8-13(14)16/h5-6,10,18H,1,7-9,11H2,2-4H3,(H,20,22)/b12-6+ |
| InChIKey | DKTADHZRZMEWLI-WUXMJOGZSA-N |
| XLogP | 4.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|