C14H19N3OS — CID 82521558
1-cyclopropyl-6-ethyl-2-oxo-7,8-dihydro-5H-1,6-naphthyridine-3-carbothioamide (PubChem CID 82521558) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is 1-cyclopropyl-6-ethyl-2-oxo-7,8-dihydro-5H-1,6-naphthyridine-3-carbothioamide.
| Compound Name | 1-cyclopropyl-6-ethyl-2-oxo-7,8-dihydro-5H-1,6-naphthyridine-3-carbothioamide |
|---|---|
| PubChem CID | 82521558 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 1-cyclopropyl-6-ethyl-2-oxo-7,8-dihydro-5H-1,6-naphthyridine-3-carbothioamide |
| SMILES | CCN1CCc2c(cc(C(N)=S)c(=O)n2C2CC2)C1 |
| InChI | InChI=1S/C14H19N3OS/c1-2-16-6-5-12-9(8-16)7-11(13(15)19)14(18)17(12)10-3-4-10/h7,10H,2-6,8H2,1H3,(H2,15,19) |
| InChIKey | WJMAYAQDBJNYMP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|