C16H22N2OS — CID 82522253
1-cyclohexyl-2-oxo-5,6,7,8-tetrahydroquinoline-3-carbothioamide (PubChem CID 82522253) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 1-cyclohexyl-2-oxo-5,6,7,8-tetrahydroquinoline-3-carbothioamide.
| Compound Name | 1-cyclohexyl-2-oxo-5,6,7,8-tetrahydroquinoline-3-carbothioamide |
|---|---|
| PubChem CID | 82522253 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-cyclohexyl-2-oxo-5,6,7,8-tetrahydroquinoline-3-carbothioamide |
| SMILES | NC(=S)c1cc2c(n(C3CCCCC3)c1=O)CCCC2 |
| InChI | InChI=1S/C16H22N2OS/c17-15(20)13-10-11-6-4-5-9-14(11)18(16(13)19)12-7-2-1-3-8-12/h10,12H,1-9H2,(H2,17,20) |
| InChIKey | JICCLPJLOJNKGH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|