C20H19FN2O3 — CID 143553117
8-ethyl-5-(5-fluoro-2-methylphenoxy)-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinoline-2,3-dione (PubChem CID 143553117) has the molecular formula C20H19FN2O3 and a molecular weight of 354.38 g/mol. Its IUPAC name is 8-ethyl-5-(5-fluoro-2-methylphenoxy)-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinoline-2,3-dione.
| Compound Name | 8-ethyl-5-(5-fluoro-2-methylphenoxy)-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinoline-2,3-dione |
|---|---|
| PubChem CID | 143553117 |
| Molecular Formula | C20H19FN2O3 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 8-ethyl-5-(5-fluoro-2-methylphenoxy)-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinoline-2,3-dione |
| SMILES | CCN1CCc2c(Oc3cc(F)ccc3C)cc3c(c2C1)NC(=O)C3=O |
| InChI | InChI=1S/C20H19FN2O3/c1-3-23-7-6-13-15(10-23)18-14(19(24)20(25)22-18)9-17(13)26-16-8-12(21)5-4-11(16)2/h4-5,8-9H,3,6-7,10H2,1-2H3,(H,22,24,25) |
| InChIKey | QQTXVNFVIHQWNS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|