C7H12N2O4 — CID 106178068
methyl (E)-3-[(3-amino-2-hydroxy-3-oxopropyl)amino]prop-2-enoate (PubChem CID 106178068) has the molecular formula C7H12N2O4 and a molecular weight of 188.18 g/mol. Its IUPAC name is methyl (E)-3-[(3-amino-2-hydroxy-3-oxopropyl)amino]prop-2-enoate.
| Compound Name | methyl (E)-3-[(3-amino-2-hydroxy-3-oxopropyl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 106178068 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | methyl (E)-3-[(3-amino-2-hydroxy-3-oxopropyl)amino]prop-2-enoate |
| SMILES | COC(=O)/C=C/NCC(O)C(N)=O |
| InChI | InChI=1S/C7H12N2O4/c1-13-6(11)2-3-9-4-5(10)7(8)12/h2-3,5,9-10H,4H2,1H3,(H2,8,12)/b3-2+ |
| InChIKey | TVFFIKMCEJAHOL-NSCUHMNNSA-N |
| XLogP | -1.89 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|