C9H16N2O3 — CID 106097408
methyl (E)-3-[(4-amino-2-methyl-4-oxobutan-2-yl)amino]prop-2-enoate (PubChem CID 106097408) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is methyl (E)-3-[(4-amino-2-methyl-4-oxobutan-2-yl)amino]prop-2-enoate.
| Compound Name | methyl (E)-3-[(4-amino-2-methyl-4-oxobutan-2-yl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 106097408 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | methyl (E)-3-[(4-amino-2-methyl-4-oxobutan-2-yl)amino]prop-2-enoate |
| SMILES | COC(=O)/C=C/NC(C)(C)CC(N)=O |
| InChI | InChI=1S/C9H16N2O3/c1-9(2,6-7(10)12)11-5-4-8(13)14-3/h4-5,11H,6H2,1-3H3,(H2,10,12)/b5-4+ |
| InChIKey | WQCFPLJGJUKWMN-SNAWJCMRSA-N |
| XLogP | -0.08 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|