C15H25NO6 — CID 126492445
4-O-[3-[[(2S)-2-hydroxy-3,3-dimethylpentanoyl]amino]propyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 126492445) has the molecular formula C15H25NO6 and a molecular weight of 315.37 g/mol. Its IUPAC name is 4-O-[3-[[(2S)-2-hydroxy-3,3-dimethylpentanoyl]amino]propyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[3-[[(2S)-2-hydroxy-3,3-dimethylpentanoyl]amino]propyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 126492445 |
| Molecular Formula | C15H25NO6 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 4-O-[3-[[(2S)-2-hydroxy-3,3-dimethylpentanoyl]amino]propyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | CCC(C)(C)[C@H](O)C(=O)NCCCOC(=O)/C=C/C(=O)OC |
| InChI | InChI=1S/C15H25NO6/c1-5-15(2,3)13(19)14(20)16-9-6-10-22-12(18)8-7-11(17)21-4/h7-8,13,19H,5-6,9-10H2,1-4H3,(H,16,20)/b8-7+/t13-/m1/s1 |
| InChIKey | HDAZRGHHWLPUKW-SBDDDAINSA-N |
| XLogP | 0.56 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|