C10H13NO7 — CID 173000955
2-[2-(4-methoxy-4-oxobut-2-enoyl)oxypropanoylamino]acetic acid (PubChem CID 173000955) has the molecular formula C10H13NO7 and a molecular weight of 259.21 g/mol. Its IUPAC name is 2-[2-(4-methoxy-4-oxobut-2-enoyl)oxypropanoylamino]acetic acid.
| Compound Name | 2-[2-(4-methoxy-4-oxobut-2-enoyl)oxypropanoylamino]acetic acid |
|---|---|
| PubChem CID | 173000955 |
| Molecular Formula | C10H13NO7 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-[2-(4-methoxy-4-oxobut-2-enoyl)oxypropanoylamino]acetic acid |
| SMILES | COC(=O)C=CC(=O)OC(C)C(=O)NCC(=O)O |
| InChI | InChI=1S/C10H13NO7/c1-6(10(16)11-5-7(12)13)18-9(15)4-3-8(14)17-2/h3-4,6H,5H2,1-2H3,(H,11,16)(H,12,13) |
| InChIKey | SVKBLTJIXVMRMH-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|