C15H23N3O10S — CID 90412230
2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid;(E)-4-methoxy-4-oxobut-2-enoic acid (PubChem CID 90412230) has the molecular formula C15H23N3O10S and a molecular weight of 437.43 g/mol. Its IUPAC name is 2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid;(E)-4-methoxy-4-oxobut-2-enoic acid.
| Compound Name | 2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid;(E)-4-methoxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 90412230 |
| Molecular Formula | C15H23N3O10S |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid;(E)-4-methoxy-4-oxobut-2-enoic acid |
| SMILES | COC(=O)/C=C/C(=O)O.NC(CCC(=O)NC(CS)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17N3O6S.C5H6O4/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16;1-9-5(8)3-2-4(6)7/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19);2-3H,1H3,(H,6,7)/b;3-2+ |
| InChIKey | GZWBRAJIAHLFGO-ZPYUXNTASA-N |
| XLogP | -2.41 |
| TPSA | 222.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|