C12H20O5 — CID 139651963
(E)-4-(2-hydroxy-3,3,4-trimethylpentoxy)-4-oxobut-2-enoic acid (PubChem CID 139651963) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is (E)-4-(2-hydroxy-3,3,4-trimethylpentoxy)-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-(2-hydroxy-3,3,4-trimethylpentoxy)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 139651963 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (E)-4-(2-hydroxy-3,3,4-trimethylpentoxy)-4-oxobut-2-enoic acid |
| SMILES | CC(C)C(C)(C)C(O)COC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C12H20O5/c1-8(2)12(3,4)9(13)7-17-11(16)6-5-10(14)15/h5-6,8-9,13H,7H2,1-4H3,(H,14,15)/b6-5+ |
| InChIKey | KBMDUOMPSPMQJV-AATRIKPKSA-N |
| XLogP | 1.21 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|