C15H12F6NO7S- — CID 140613868
2-[3-(benzylamino)-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1-difluoroethanesulfonate (PubChem CID 140613868) has the molecular formula C15H12F6NO7S- and a molecular weight of 464.32 g/mol. Its IUPAC name is 2-[3-(benzylamino)-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1-difluoroethanesulfonate.
| Compound Name | 2-[3-(benzylamino)-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 140613868 |
| Molecular Formula | C15H12F6NO7S- |
| Molecular Weight | 464.32 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | 2-[3-(benzylamino)-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1-difluoroethanesulfonate |
| SMILES | C=C(F)C(=O)OC(OCC(F)(F)S(=O)(=O)[O-])(C(=O)NCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H13F6NO7S/c1-9(16)11(23)29-14(15(19,20)21,28-8-13(17,18)30(25,26)27)12(24)22-7-10-5-3-2-4-6-10/h2-6H,1,7-8H2,(H,22,24)(H,25,26,27)/p-1 |
| InChIKey | VKHWJZYHQXODPS-UHFFFAOYSA-M |
| XLogP | 1.74 |
| TPSA | 121.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|