C17H14F8NO7S- — CID 140614207
4-[3-(benzylamino)-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonate (PubChem CID 140614207) has the molecular formula C17H14F8NO7S- and a molecular weight of 528.35 g/mol. Its IUPAC name is 4-[3-(benzylamino)-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonate.
| Compound Name | 4-[3-(benzylamino)-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 140614207 |
| Molecular Formula | C17H14F8NO7S- |
| Molecular Weight | 528.35 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | 4-[3-(benzylamino)-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonate |
| SMILES | C=C(F)C(=O)OC(OCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(C(=O)NCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H15F8NO7S/c1-10(18)12(27)33-15(16(21,22)23,13(28)26-9-11-5-3-2-4-6-11)32-8-7-14(19,20)17(24,25)34(29,30)31/h2-6H,1,7-9H2,(H,26,28)(H,29,30,31)/p-1 |
| InChIKey | RFGQCNDZLIVZGN-UHFFFAOYSA-M |
| XLogP | 2.77 |
| TPSA | 121.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|