C18H13F10O8S- — CID 140614179
1,1,2,2-tetrafluoro-4-[1,1,1-trifluoro-3-oxo-3-phenylmethoxy-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxybutane-1-sulfonate (PubChem CID 140614179) has the molecular formula C18H13F10O8S- and a molecular weight of 579.34 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-[1,1,1-trifluoro-3-oxo-3-phenylmethoxy-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxybutane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-4-[1,1,1-trifluoro-3-oxo-3-phenylmethoxy-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxybutane-1-sulfonate |
|---|---|
| PubChem CID | 140614179 |
| Molecular Formula | C18H13F10O8S- |
| Molecular Weight | 579.34 g/mol |
| Exact Mass | 579.02 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-[1,1,1-trifluoro-3-oxo-3-phenylmethoxy-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxybutane-1-sulfonate |
| SMILES | C=C(C(=O)OC(OCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(C(=O)OCc1ccccc1)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H14F10O8S/c1-10(16(21,22)23)12(29)36-15(17(24,25)26,13(30)34-9-11-5-3-2-4-6-11)35-8-7-14(19,20)18(27,28)37(31,32)33/h2-6H,1,7-9H2,(H,31,32,33)/p-1 |
| InChIKey | FUAJZZHRTIIWLZ-UHFFFAOYSA-M |
| XLogP | 3.83 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|