C27H9F25O2 — CID 150764571
[3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-hexadecafluoro-9-(2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl)decyl] 2-methylprop-2-enoate (PubChem CID 150764571) has the molecular formula C27H9F25O2 and a molecular weight of 840.32 g/mol. Its IUPAC name is [3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-hexadecafluoro-9-(2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl)decyl] 2-methylprop-2-enoate.
| Compound Name | [3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-hexadecafluoro-9-(2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl)decyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 150764571 |
| Molecular Formula | C27H9F25O2 |
| Molecular Weight | 840.32 g/mol |
| Exact Mass | 840.02 |
| IUPAC Name | [3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-hexadecafluoro-9-(2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl)decyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(c1c(F)c(F)c(F)c2c1C(F)(F)c1c(F)c(F)c(F)c(F)c1-2)C(F)(F)F |
| InChI | InChI=1S/C27H9F25O2/c1-5(2)18(53)54-4-3-19(35,36)22(40,41)24(44,45)26(48,49)25(46,47)23(42,43)21(39,27(50,51)52)10-8-6(11(28)15(32)14(10)31)7-9(20(8,37)38)13(30)17(34)16(33)12(7)29/h1,3-4H2,2H3 |
| InChIKey | JYNRMBYCNMLWIT-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.32 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|