C12H13F5O6 — CID 162545268
1-O-methyl 4-O-(2,2,2-trifluoroethyl) 3,3-difluoro-2-methyl-2-(2-methylprop-2-enoyloxy)butanedioate (PubChem CID 162545268) has the molecular formula C12H13F5O6 and a molecular weight of 348.22 g/mol. Its IUPAC name is 1-O-methyl 4-O-(2,2,2-trifluoroethyl) 3,3-difluoro-2-methyl-2-(2-methylprop-2-enoyloxy)butanedioate.
| Compound Name | 1-O-methyl 4-O-(2,2,2-trifluoroethyl) 3,3-difluoro-2-methyl-2-(2-methylprop-2-enoyloxy)butanedioate |
|---|---|
| PubChem CID | 162545268 |
| Molecular Formula | C12H13F5O6 |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 1-O-methyl 4-O-(2,2,2-trifluoroethyl) 3,3-difluoro-2-methyl-2-(2-methylprop-2-enoyloxy)butanedioate |
| SMILES | C=C(C)C(=O)OC(C)(C(=O)OC)C(F)(F)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C12H13F5O6/c1-6(2)7(18)23-10(3,8(19)21-4)12(16,17)9(20)22-5-11(13,14)15/h1,5H2,2-4H3 |
| InChIKey | MWOZMHNFIROPIQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|