C11H16F2O5S — CID 88551950
[2-(2,2-difluoro-2-sulfanylethoxy)-1-ethoxy-1-oxopropan-2-yl] 2-methylprop-2-enoate (PubChem CID 88551950) has the molecular formula C11H16F2O5S and a molecular weight of 298.31 g/mol. Its IUPAC name is [2-(2,2-difluoro-2-sulfanylethoxy)-1-ethoxy-1-oxopropan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [2-(2,2-difluoro-2-sulfanylethoxy)-1-ethoxy-1-oxopropan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88551950 |
| Molecular Formula | C11H16F2O5S |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | [2-(2,2-difluoro-2-sulfanylethoxy)-1-ethoxy-1-oxopropan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(OCC(F)(F)S)C(=O)OCC |
| InChI | InChI=1S/C11H16F2O5S/c1-5-16-9(15)10(4,17-6-11(12,13)19)18-8(14)7(2)3/h19H,2,5-6H2,1,3-4H3 |
| InChIKey | ATCUAGHXUOZPJB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|