C14H18F4O6S — CID 88551849
[1-oxo-1-(2-oxopropoxy)-2-(3,3,4,4-tetrafluoro-4-sulfanylbutoxy)propan-2-yl] 2-methylprop-2-enoate (PubChem CID 88551849) has the molecular formula C14H18F4O6S and a molecular weight of 390.35 g/mol. Its IUPAC name is [1-oxo-1-(2-oxopropoxy)-2-(3,3,4,4-tetrafluoro-4-sulfanylbutoxy)propan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-oxo-1-(2-oxopropoxy)-2-(3,3,4,4-tetrafluoro-4-sulfanylbutoxy)propan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88551849 |
| Molecular Formula | C14H18F4O6S |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | [1-oxo-1-(2-oxopropoxy)-2-(3,3,4,4-tetrafluoro-4-sulfanylbutoxy)propan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(OCCC(F)(F)C(F)(F)S)C(=O)OCC(C)=O |
| InChI | InChI=1S/C14H18F4O6S/c1-8(2)10(20)24-12(4,11(21)22-7-9(3)19)23-6-5-13(15,16)14(17,18)25/h25H,1,5-7H2,2-4H3 |
| InChIKey | XQTQZRKNADRVLT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|