C13H13Cl3O5S — CID 15508959
2-(2,4,6-trichlorophenyl)sulfonyloxypropyl 2-methylprop-2-enoate (PubChem CID 15508959) has the molecular formula C13H13Cl3O5S and a molecular weight of 387.67 g/mol. Its IUPAC name is 2-(2,4,6-trichlorophenyl)sulfonyloxypropyl 2-methylprop-2-enoate.
| Compound Name | 2-(2,4,6-trichlorophenyl)sulfonyloxypropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 15508959 |
| Molecular Formula | C13H13Cl3O5S |
| Molecular Weight | 387.67 g/mol |
| Exact Mass | 385.95 |
| IUPAC Name | 2-(2,4,6-trichlorophenyl)sulfonyloxypropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)OS(=O)(=O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl3O5S/c1-7(2)13(17)20-6-8(3)21-22(18,19)12-10(15)4-9(14)5-11(12)16/h4-5,8H,1,6H2,2-3H3 |
| InChIKey | ININUTHPEMCVPY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.67 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|