C27H29NO6 — CID 166955980
[2-[4-[4-(2-methylprop-2-enimidoyloxy)phenyl]phenoxy]-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate (PubChem CID 166955980) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is [2-[4-[4-(2-methylprop-2-enimidoyloxy)phenyl]phenoxy]-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate.
| Compound Name | [2-[4-[4-(2-methylprop-2-enimidoyloxy)phenyl]phenoxy]-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 166955980 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | [2-[4-[4-(2-methylprop-2-enimidoyloxy)phenyl]phenoxy]-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate |
| SMILES | [H]/N=C(/Oc1ccc(-c2ccc(OC(COC(=O)C(=C)C)COC(=O)C(=C)C)cc2)cc1)C(=C)C |
| InChI | InChI=1S/C27H29NO6/c1-17(2)25(28)34-23-13-9-21(10-14-23)20-7-11-22(12-8-20)33-24(15-31-26(29)18(3)4)16-32-27(30)19(5)6/h7-14,24,28H,1,3,5,15-16H2,2,4,6H3/b28-25+ |
| InChIKey | MCNCAVPIPXHYKB-AZPGRJICSA-N |
| XLogP | 5.27 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|