C18H17ClO4 — CID 154115811
2-(4-butanoylphenoxy)-2-(4-chlorophenyl)acetic acid (PubChem CID 154115811) has the molecular formula C18H17ClO4 and a molecular weight of 332.78 g/mol. Its IUPAC name is 2-(4-butanoylphenoxy)-2-(4-chlorophenyl)acetic acid.
| Compound Name | 2-(4-butanoylphenoxy)-2-(4-chlorophenyl)acetic acid |
|---|---|
| PubChem CID | 154115811 |
| Molecular Formula | C18H17ClO4 |
| Molecular Weight | 332.78 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2-(4-butanoylphenoxy)-2-(4-chlorophenyl)acetic acid |
| SMILES | CCCC(=O)c1ccc(OC(C(=O)O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H17ClO4/c1-2-3-16(20)12-6-10-15(11-7-12)23-17(18(21)22)13-4-8-14(19)9-5-13/h4-11,17H,2-3H2,1H3,(H,21,22) |
| InChIKey | NOPYONHQRFSHOP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.78 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |