C11H10O4 — CID 18355636
but-3-ynyl 2,4-dihydroxybenzoate (PubChem CID 18355636) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is but-3-ynyl 2,4-dihydroxybenzoate.
| Compound Name | but-3-ynyl 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 18355636 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | but-3-ynyl 2,4-dihydroxybenzoate |
| SMILES | C#CCCOC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C11H10O4/c1-2-3-6-15-11(14)9-5-4-8(12)7-10(9)13/h1,4-5,7,12-13H,3,6H2 |
| InChIKey | QSNMOZGFMXNHOL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|