C20H24O4 — CID 5123968
(4-tert-butyl-2,6-dimethylphenyl)methyl 2,4-dihydroxybenzoate (PubChem CID 5123968) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (4-tert-butyl-2,6-dimethylphenyl)methyl 2,4-dihydroxybenzoate.
| Compound Name | (4-tert-butyl-2,6-dimethylphenyl)methyl 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 5123968 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (4-tert-butyl-2,6-dimethylphenyl)methyl 2,4-dihydroxybenzoate |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1COC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C20H24O4/c1-12-8-14(20(3,4)5)9-13(2)17(12)11-24-19(23)16-7-6-15(21)10-18(16)22/h6-10,21-22H,11H2,1-5H3 |
| InChIKey | QZWCXMBPIBSMGI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |