C22H28O4 — CID 7487725
(4-tert-butyl-2,6-dimethylphenyl)methyl 2,5-dimethoxybenzoate (PubChem CID 7487725) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is (4-tert-butyl-2,6-dimethylphenyl)methyl 2,5-dimethoxybenzoate.
| Compound Name | (4-tert-butyl-2,6-dimethylphenyl)methyl 2,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 7487725 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (4-tert-butyl-2,6-dimethylphenyl)methyl 2,5-dimethoxybenzoate |
| SMILES | COc1ccc(OC)c(C(=O)OCc2c(C)cc(C(C)(C)C)cc2C)c1 |
| InChI | InChI=1S/C22H28O4/c1-14-10-16(22(3,4)5)11-15(2)19(14)13-26-21(23)18-12-17(24-6)8-9-20(18)25-7/h8-12H,13H2,1-7H3 |
| InChIKey | WEWBXPZWUHGFKI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |