C40H46O10 — CID 18380077
[4-[3-[8-[3-(4-benzoyl-3-hydroxyphenoxy)-2-hydroxypropoxy]octoxy]-2-hydroxypropoxy]-2-hydroxyphenyl]-phenylmethanone (PubChem CID 18380077) has the molecular formula C40H46O10 and a molecular weight of 686.80 g/mol. Its IUPAC name is [4-[3-[8-[3-(4-benzoyl-3-hydroxyphenoxy)-2-hydroxypropoxy]octoxy]-2-hydroxypropoxy]-2-hydroxyphenyl]-phenylmethanone.
| Compound Name | [4-[3-[8-[3-(4-benzoyl-3-hydroxyphenoxy)-2-hydroxypropoxy]octoxy]-2-hydroxypropoxy]-2-hydroxyphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 18380077 |
| Molecular Formula | C40H46O10 |
| Molecular Weight | 686.80 g/mol |
| Exact Mass | 686.31 |
| IUPAC Name | [4-[3-[8-[3-(4-benzoyl-3-hydroxyphenoxy)-2-hydroxypropoxy]octoxy]-2-hydroxypropoxy]-2-hydroxyphenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(OCC(O)COCCCCCCCCOCC(O)COc2ccc(C(=O)c3ccccc3)c(O)c2)cc1O |
| InChI | InChI=1S/C40H46O10/c41-31(27-49-33-17-19-35(37(43)23-33)39(45)29-13-7-5-8-14-29)25-47-21-11-3-1-2-4-12-22-48-26-32(42)28-50-34-18-20-36(38(44)24-34)40(46)30-15-9-6-10-16-30/h5-10,13-20,23-24,31-32,41-44H,1-4,11-12,21-22,25-28H2 |
| InChIKey | KBUVOHSYJIAUCX-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.80 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|