C38H42O10 — CID 70148317
[4-[3-[1-[3-(4-benzoyl-3-hydroxyphenoxy)-2-hydroxypropoxy]hexoxy]-2-hydroxypropoxy]-2-hydroxyphenyl]-phenylmethanone (PubChem CID 70148317) has the molecular formula C38H42O10 and a molecular weight of 658.74 g/mol. Its IUPAC name is [4-[3-[1-[3-(4-benzoyl-3-hydroxyphenoxy)-2-hydroxypropoxy]hexoxy]-2-hydroxypropoxy]-2-hydroxyphenyl]-phenylmethanone.
| Compound Name | [4-[3-[1-[3-(4-benzoyl-3-hydroxyphenoxy)-2-hydroxypropoxy]hexoxy]-2-hydroxypropoxy]-2-hydroxyphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 70148317 |
| Molecular Formula | C38H42O10 |
| Molecular Weight | 658.74 g/mol |
| Exact Mass | 658.28 |
| IUPAC Name | [4-[3-[1-[3-(4-benzoyl-3-hydroxyphenoxy)-2-hydroxypropoxy]hexoxy]-2-hydroxypropoxy]-2-hydroxyphenyl]-phenylmethanone |
| SMILES | CCCCCC(OCC(O)COc1ccc(C(=O)c2ccccc2)c(O)c1)OCC(O)COc1ccc(C(=O)c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C38H42O10/c1-2-3-6-15-36(47-24-28(39)22-45-30-16-18-32(34(41)20-30)37(43)26-11-7-4-8-12-26)48-25-29(40)23-46-31-17-19-33(35(42)21-31)38(44)27-13-9-5-10-14-27/h4-5,7-14,16-21,28-29,36,39-42H,2-3,6,15,22-25H2,1H3 |
| InChIKey | IGYUJCFCOMWEHR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.74 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|