C43H52O6 — CID 70603392
[4-[3-[(3-benzoyl-2-hydroxy-6-octoxyphenyl)methyl]octoxy]-2-hydroxyphenyl]-phenylmethanone (PubChem CID 70603392) has the molecular formula C43H52O6 and a molecular weight of 664.88 g/mol. Its IUPAC name is [4-[3-[(3-benzoyl-2-hydroxy-6-octoxyphenyl)methyl]octoxy]-2-hydroxyphenyl]-phenylmethanone.
| Compound Name | [4-[3-[(3-benzoyl-2-hydroxy-6-octoxyphenyl)methyl]octoxy]-2-hydroxyphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 70603392 |
| Molecular Formula | C43H52O6 |
| Molecular Weight | 664.88 g/mol |
| Exact Mass | 664.38 |
| IUPAC Name | [4-[3-[(3-benzoyl-2-hydroxy-6-octoxyphenyl)methyl]octoxy]-2-hydroxyphenyl]-phenylmethanone |
| SMILES | CCCCCCCCOc1ccc(C(=O)c2ccccc2)c(O)c1CC(CCCCC)CCOc1ccc(C(=O)c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C43H52O6/c1-3-5-7-8-9-17-28-49-40-26-25-37(42(46)34-21-15-11-16-22-34)43(47)38(40)30-32(18-12-6-4-2)27-29-48-35-23-24-36(39(44)31-35)41(45)33-19-13-10-14-20-33/h10-11,13-16,19-26,31-32,44,47H,3-9,12,17-18,27-30H2,1-2H3 |
| InChIKey | JUDBEEJKCUOFRT-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.88 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|