About methyl 2-amino-3-butoxybenzoate
methyl 2-amino-3-butoxybenzoate (PubChem CID 61039982) has the molecular formula C12H17NO3
and a molecular weight of 223.27 g/mol. Its IUPAC name is methyl 2-amino-3-butoxybenzoate.
Molecular Properties
| Compound Name | methyl 2-amino-3-butoxybenzoate |
| PubChem CID | 61039982 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | methyl 2-amino-3-butoxybenzoate |
| SMILES | CCCCOc1cccc(C(=O)OC)c1N |
| InChI | InChI=1S/C12H17NO3/c1-3-4-8-16-10-7-5-6-9(11(10)13)12(14)15-2/h5-7H,3-4,8,13H2,1-2H3 |
| InChIKey | VCBAWVRHVNPNQC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-amino-3-butoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-3-butoxybenzoate?
The IUPAC name of methyl 2-amino-3-butoxybenzoate (CID 61039982) is methyl 2-amino-3-butoxybenzoate.
What is the SMILES notation for methyl 2-amino-3-butoxybenzoate?
The canonical SMILES for methyl 2-amino-3-butoxybenzoate is CCCCOc1cccc(C(=O)OC)c1N.
What is the InChIKey of methyl 2-amino-3-butoxybenzoate?
The InChIKey is VCBAWVRHVNPNQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3/c1-3-4-8-16-10-7-5-6-9(11(10)13)12(14)15-2/h5-7H,3-4,8,13H2,1-2H3.
What are the key properties of methyl 2-amino-3-butoxybenzoate?
methyl 2-amino-3-butoxybenzoate has a molecular weight of 223.27 g/mol, XLogP of 2.23, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-3-butoxybenzoate is sourced from PubChem (CID 61039982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).