C11H15ClN2O2 — CID 65101759
4-[(2-chloro-3-pyridinyl)oxy]-N,N-dimethylbutanamide (PubChem CID 65101759) has the molecular formula C11H15ClN2O2 and a molecular weight of 242.71 g/mol. Its IUPAC name is 4-[(2-chloro-3-pyridinyl)oxy]-N,N-dimethylbutanamide.
| Compound Name | 4-[(2-chloro-3-pyridinyl)oxy]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 65101759 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 4-[(2-chloro-3-pyridinyl)oxy]-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCOc1cccnc1Cl |
| InChI | InChI=1S/C11H15ClN2O2/c1-14(2)10(15)6-4-8-16-9-5-3-7-13-11(9)12/h3,5,7H,4,6,8H2,1-2H3 |
| InChIKey | AELYCPYERVTLLE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|