C12H19N3O2 — CID 62100009
4-[(2-amino-6-methyl-3-pyridinyl)oxy]-N,N-dimethylbutanamide (PubChem CID 62100009) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-[(2-amino-6-methyl-3-pyridinyl)oxy]-N,N-dimethylbutanamide.
| Compound Name | 4-[(2-amino-6-methyl-3-pyridinyl)oxy]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 62100009 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 4-[(2-amino-6-methyl-3-pyridinyl)oxy]-N,N-dimethylbutanamide |
| SMILES | Cc1ccc(OCCCC(=O)N(C)C)c(N)n1 |
| InChI | InChI=1S/C12H19N3O2/c1-9-6-7-10(12(13)14-9)17-8-4-5-11(16)15(2)3/h6-7H,4-5,8H2,1-3H3,(H2,13,14) |
| InChIKey | COZKKSWCZKIQCM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|