About (2-chloro-3-pyridinyl) 4-ethoxybutanoate
(2-chloro-3-pyridinyl) 4-ethoxybutanoate (PubChem CID 71930736) has the molecular formula C11H14ClNO3
and a molecular weight of 243.69 g/mol. Its IUPAC name is (2-chloro-3-pyridinyl) 4-ethoxybutanoate.
Molecular Properties
| Compound Name | (2-chloro-3-pyridinyl) 4-ethoxybutanoate |
| PubChem CID | 71930736 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (2-chloro-3-pyridinyl) 4-ethoxybutanoate |
| SMILES | CCOCCCC(=O)Oc1cccnc1Cl |
| InChI | InChI=1S/C11H14ClNO3/c1-2-15-8-4-6-10(14)16-9-5-3-7-13-11(9)12/h3,5,7H,2,4,6,8H2,1H3 |
| InChIKey | FEWPDWPGOZSFKQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-3-pyridinyl) 4-ethoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-3-pyridinyl) 4-ethoxybutanoate?
The IUPAC name of (2-chloro-3-pyridinyl) 4-ethoxybutanoate (CID 71930736) is (2-chloro-3-pyridinyl) 4-ethoxybutanoate.
What is the SMILES notation for (2-chloro-3-pyridinyl) 4-ethoxybutanoate?
The canonical SMILES for (2-chloro-3-pyridinyl) 4-ethoxybutanoate is CCOCCCC(=O)Oc1cccnc1Cl.
What is the InChIKey of (2-chloro-3-pyridinyl) 4-ethoxybutanoate?
The InChIKey is FEWPDWPGOZSFKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNO3/c1-2-15-8-4-6-10(14)16-9-5-3-7-13-11(9)12/h3,5,7H,2,4,6,8H2,1H3.
What are the key properties of (2-chloro-3-pyridinyl) 4-ethoxybutanoate?
(2-chloro-3-pyridinyl) 4-ethoxybutanoate has a molecular weight of 243.69 g/mol, XLogP of 2.46, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-3-pyridinyl) 4-ethoxybutanoate is sourced from PubChem (CID 71930736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).