About (2-chloro-3-pyridinyl) 2-hydroxypropanoate
(2-chloro-3-pyridinyl) 2-hydroxypropanoate (PubChem CID 131201350) has the molecular formula C8H8ClNO3
and a molecular weight of 201.61 g/mol. Its IUPAC name is (2-chloro-3-pyridinyl) 2-hydroxypropanoate.
Molecular Properties
| Compound Name | (2-chloro-3-pyridinyl) 2-hydroxypropanoate |
| PubChem CID | 131201350 |
| Molecular Formula | C8H8ClNO3 |
| Molecular Weight | 201.61 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | (2-chloro-3-pyridinyl) 2-hydroxypropanoate |
| SMILES | CC(O)C(=O)Oc1cccnc1Cl |
| InChI | InChI=1S/C8H8ClNO3/c1-5(11)8(12)13-6-3-2-4-10-7(6)9/h2-5,11H,1H3 |
| InChIKey | NGIHQTGPSNHORP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.61 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-3-pyridinyl) 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-3-pyridinyl) 2-hydroxypropanoate?
The IUPAC name of (2-chloro-3-pyridinyl) 2-hydroxypropanoate (CID 131201350) is (2-chloro-3-pyridinyl) 2-hydroxypropanoate.
What is the SMILES notation for (2-chloro-3-pyridinyl) 2-hydroxypropanoate?
The canonical SMILES for (2-chloro-3-pyridinyl) 2-hydroxypropanoate is CC(O)C(=O)Oc1cccnc1Cl.
What is the InChIKey of (2-chloro-3-pyridinyl) 2-hydroxypropanoate?
The InChIKey is NGIHQTGPSNHORP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO3/c1-5(11)8(12)13-6-3-2-4-10-7(6)9/h2-5,11H,1H3.
What are the key properties of (2-chloro-3-pyridinyl) 2-hydroxypropanoate?
(2-chloro-3-pyridinyl) 2-hydroxypropanoate has a molecular weight of 201.61 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-3-pyridinyl) 2-hydroxypropanoate is sourced from PubChem (CID 131201350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).