About (2-chloro-3-pyridinyl) azetidine-1-carboxylate
(2-chloro-3-pyridinyl) azetidine-1-carboxylate (PubChem CID 169229257) has the molecular formula C9H9ClN2O2
and a molecular weight of 212.64 g/mol. Its IUPAC name is (2-chloro-3-pyridinyl) azetidine-1-carboxylate.
Molecular Properties
| Compound Name | (2-chloro-3-pyridinyl) azetidine-1-carboxylate |
| PubChem CID | 169229257 |
| Molecular Formula | C9H9ClN2O2 |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | (2-chloro-3-pyridinyl) azetidine-1-carboxylate |
| SMILES | O=C(Oc1cccnc1Cl)N1CCC1 |
| InChI | InChI=1S/C9H9ClN2O2/c10-8-7(3-1-4-11-8)14-9(13)12-5-2-6-12/h1,3-4H,2,5-6H2 |
| InChIKey | YTYFGAANWFUTHE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-3-pyridinyl) azetidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-3-pyridinyl) azetidine-1-carboxylate?
The IUPAC name of (2-chloro-3-pyridinyl) azetidine-1-carboxylate (CID 169229257) is (2-chloro-3-pyridinyl) azetidine-1-carboxylate.
What is the SMILES notation for (2-chloro-3-pyridinyl) azetidine-1-carboxylate?
The canonical SMILES for (2-chloro-3-pyridinyl) azetidine-1-carboxylate is O=C(Oc1cccnc1Cl)N1CCC1.
What is the InChIKey of (2-chloro-3-pyridinyl) azetidine-1-carboxylate?
The InChIKey is YTYFGAANWFUTHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN2O2/c10-8-7(3-1-4-11-8)14-9(13)12-5-2-6-12/h1,3-4H,2,5-6H2.
What are the key properties of (2-chloro-3-pyridinyl) azetidine-1-carboxylate?
(2-chloro-3-pyridinyl) azetidine-1-carboxylate has a molecular weight of 212.64 g/mol, XLogP of 1.94, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-3-pyridinyl) azetidine-1-carboxylate is sourced from PubChem (CID 169229257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).