About [5-(aminomethyl)-3-chloropyrazin-2-yl] azetidine-1-carboxylate
[5-(aminomethyl)-3-chloropyrazin-2-yl] azetidine-1-carboxylate (PubChem CID 177314415) has the molecular formula C9H11ClN4O2
and a molecular weight of 242.67 g/mol. Its IUPAC name is [5-(aminomethyl)-3-chloropyrazin-2-yl] azetidine-1-carboxylate.
Molecular Properties
| Compound Name | [5-(aminomethyl)-3-chloropyrazin-2-yl] azetidine-1-carboxylate |
| PubChem CID | 177314415 |
| Molecular Formula | C9H11ClN4O2 |
| Molecular Weight | 242.67 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | [5-(aminomethyl)-3-chloropyrazin-2-yl] azetidine-1-carboxylate |
| SMILES | NCc1cnc(OC(=O)N2CCC2)c(Cl)n1 |
| InChI | InChI=1S/C9H11ClN4O2/c10-7-8(12-5-6(4-11)13-7)16-9(15)14-2-1-3-14/h5H,1-4,11H2 |
| InChIKey | XRHZXRVOIZCJES-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.67 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(aminomethyl)-3-chloropyrazin-2-yl] azetidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(aminomethyl)-3-chloropyrazin-2-yl] azetidine-1-carboxylate?
The IUPAC name of [5-(aminomethyl)-3-chloropyrazin-2-yl] azetidine-1-carboxylate (CID 177314415) is [5-(aminomethyl)-3-chloropyrazin-2-yl] azetidine-1-carboxylate.
What is the SMILES notation for [5-(aminomethyl)-3-chloropyrazin-2-yl] azetidine-1-carboxylate?
The canonical SMILES for [5-(aminomethyl)-3-chloropyrazin-2-yl] azetidine-1-carboxylate is NCc1cnc(OC(=O)N2CCC2)c(Cl)n1.
What is the InChIKey of [5-(aminomethyl)-3-chloropyrazin-2-yl] azetidine-1-carboxylate?
The InChIKey is XRHZXRVOIZCJES-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN4O2/c10-7-8(12-5-6(4-11)13-7)16-9(15)14-2-1-3-14/h5H,1-4,11H2.
What are the key properties of [5-(aminomethyl)-3-chloropyrazin-2-yl] azetidine-1-carboxylate?
[5-(aminomethyl)-3-chloropyrazin-2-yl] azetidine-1-carboxylate has a molecular weight of 242.67 g/mol, XLogP of 0.79, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(aminomethyl)-3-chloropyrazin-2-yl] azetidine-1-carboxylate is sourced from PubChem (CID 177314415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).