About pyridazin-4-yl piperidine-1-carboxylate
pyridazin-4-yl piperidine-1-carboxylate (PubChem CID 175189691) has the molecular formula C10H13N3O2
and a molecular weight of 207.23 g/mol. Its IUPAC name is pyridazin-4-yl piperidine-1-carboxylate.
Molecular Properties
| Compound Name | pyridazin-4-yl piperidine-1-carboxylate |
| PubChem CID | 175189691 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | pyridazin-4-yl piperidine-1-carboxylate |
| SMILES | O=C(Oc1ccnnc1)N1CCCCC1 |
| InChI | InChI=1S/C10H13N3O2/c14-10(13-6-2-1-3-7-13)15-9-4-5-11-12-8-9/h4-5,8H,1-3,6-7H2 |
| InChIKey | LIRRQBUQMRRLOU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridazin-4-yl piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridazin-4-yl piperidine-1-carboxylate?
The IUPAC name of pyridazin-4-yl piperidine-1-carboxylate (CID 175189691) is pyridazin-4-yl piperidine-1-carboxylate.
What is the SMILES notation for pyridazin-4-yl piperidine-1-carboxylate?
The canonical SMILES for pyridazin-4-yl piperidine-1-carboxylate is O=C(Oc1ccnnc1)N1CCCCC1.
What is the InChIKey of pyridazin-4-yl piperidine-1-carboxylate?
The InChIKey is LIRRQBUQMRRLOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2/c14-10(13-6-2-1-3-7-13)15-9-4-5-11-12-8-9/h4-5,8H,1-3,6-7H2.
What are the key properties of pyridazin-4-yl piperidine-1-carboxylate?
pyridazin-4-yl piperidine-1-carboxylate has a molecular weight of 207.23 g/mol, XLogP of 1.46, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridazin-4-yl piperidine-1-carboxylate is sourced from PubChem (CID 175189691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).