About pyrazin-2-yl pyrrolidine-1-carboxylate
pyrazin-2-yl pyrrolidine-1-carboxylate (PubChem CID 154365192) has the molecular formula C9H11N3O2
and a molecular weight of 193.21 g/mol. Its IUPAC name is pyrazin-2-yl pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | pyrazin-2-yl pyrrolidine-1-carboxylate |
| PubChem CID | 154365192 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | pyrazin-2-yl pyrrolidine-1-carboxylate |
| SMILES | O=C(Oc1cnccn1)N1CCCC1 |
| InChI | InChI=1S/C9H11N3O2/c13-9(12-5-1-2-6-12)14-8-7-10-3-4-11-8/h3-4,7H,1-2,5-6H2 |
| InChIKey | SEQXCUNDWBXRMJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrazin-2-yl pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazin-2-yl pyrrolidine-1-carboxylate?
The IUPAC name of pyrazin-2-yl pyrrolidine-1-carboxylate (CID 154365192) is pyrazin-2-yl pyrrolidine-1-carboxylate.
What is the SMILES notation for pyrazin-2-yl pyrrolidine-1-carboxylate?
The canonical SMILES for pyrazin-2-yl pyrrolidine-1-carboxylate is O=C(Oc1cnccn1)N1CCCC1.
What is the InChIKey of pyrazin-2-yl pyrrolidine-1-carboxylate?
The InChIKey is SEQXCUNDWBXRMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2/c13-9(12-5-1-2-6-12)14-8-7-10-3-4-11-8/h3-4,7H,1-2,5-6H2.
What are the key properties of pyrazin-2-yl pyrrolidine-1-carboxylate?
pyrazin-2-yl pyrrolidine-1-carboxylate has a molecular weight of 193.21 g/mol, XLogP of 1.07, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazin-2-yl pyrrolidine-1-carboxylate is sourced from PubChem (CID 154365192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).